C11H14N2O5S — CID 145324204
methyl (6R,7R)-3-ethyl-7-formamido-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboperoxoate (PubChem CID 145324204) has the molecular formula C11H14N2O5S and a molecular weight of 286.31 g/mol. Its IUPAC name is methyl (6R,7R)-3-ethyl-7-formamido-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboperoxoate.
| Compound Name | methyl (6R,7R)-3-ethyl-7-formamido-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboperoxoate |
|---|---|
| PubChem CID | 145324204 |
| Molecular Formula | C11H14N2O5S |
| Molecular Weight | 286.31 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | methyl (6R,7R)-3-ethyl-7-formamido-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboperoxoate |
| SMILES | CCC1=C(C(=O)OOC)N2C(=O)[C@@H](NC=O)[C@H]2SC1 |
| InChI | InChI=1S/C11H14N2O5S/c1-3-6-4-19-10-7(12-5-14)9(15)13(10)8(6)11(16)18-17-2/h5,7,10H,3-4H2,1-2H3,(H,12,14)/t7-,10-/m1/s1 |
| InChIKey | BHLITWXGIVHBJE-GMSGAONNSA-N |
| XLogP | -0.22 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.31 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|