C9H9ClN2O4S — CID 54550323
(6S,7R)-3-(chloromethyl)-7-formamido-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 54550323) has the molecular formula C9H9ClN2O4S and a molecular weight of 276.70 g/mol. Its IUPAC name is (6S,7R)-3-(chloromethyl)-7-formamido-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6S,7R)-3-(chloromethyl)-7-formamido-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 54550323 |
| Molecular Formula | C9H9ClN2O4S |
| Molecular Weight | 276.70 g/mol |
| Exact Mass | 276.00 |
| IUPAC Name | (6S,7R)-3-(chloromethyl)-7-formamido-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | O=CN[C@@H]1C(=O)N2C(C(=O)O)=C(CCl)CS[C@@H]12 |
| InChI | InChI=1S/C9H9ClN2O4S/c10-1-4-2-17-8-5(11-3-13)7(14)12(8)6(4)9(15)16/h3,5,8H,1-2H2,(H,11,13)(H,15,16)/t5-,8+/m1/s1 |
| InChIKey | ZJKWRKAUIHFHEA-XRGYYRRGSA-N |
| XLogP | -0.41 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.70 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|