C9H8N2O5S — CID 88815718
(6R)-7-formamido-3-formyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 88815718) has the molecular formula C9H8N2O5S and a molecular weight of 256.24 g/mol. Its IUPAC name is (6R)-7-formamido-3-formyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6R)-7-formamido-3-formyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 88815718 |
| Molecular Formula | C9H8N2O5S |
| Molecular Weight | 256.24 g/mol |
| Exact Mass | 256.02 |
| IUPAC Name | (6R)-7-formamido-3-formyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | O=CNC1C(=O)N2C(C(=O)O)=C(C=O)CS[C@H]12 |
| InChI | InChI=1S/C9H8N2O5S/c12-1-4-2-17-8-5(10-3-13)7(14)11(8)6(4)9(15)16/h1,3,5,8H,2H2,(H,10,13)(H,15,16)/t5?,8-/m1/s1 |
| InChIKey | NHSFOYJZGPYQNW-XCGJVMPOSA-N |
| XLogP | -1.45 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.24 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|