C14H11N3O7S — CID 88821635
(6S)-7-formamido-3-[2-(5-nitrofuran-2-yl)ethenyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 88821635) has the molecular formula C14H11N3O7S and a molecular weight of 365.32 g/mol. Its IUPAC name is (6S)-7-formamido-3-[2-(5-nitrofuran-2-yl)ethenyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6S)-7-formamido-3-[2-(5-nitrofuran-2-yl)ethenyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 88821635 |
| Molecular Formula | C14H11N3O7S |
| Molecular Weight | 365.32 g/mol |
| Exact Mass | 365.03 |
| IUPAC Name | (6S)-7-formamido-3-[2-(5-nitrofuran-2-yl)ethenyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | O=CNC1C(=O)N2C(C(=O)O)=C(C=Cc3ccc([N+](=O)[O-])o3)CS[C@@H]12 |
| InChI | InChI=1S/C14H11N3O7S/c18-6-15-10-12(19)16-11(14(20)21)7(5-25-13(10)16)1-2-8-3-4-9(24-8)17(22)23/h1-4,6,10,13H,5H2,(H,15,18)(H,20,21)/t10?,13-/m0/s1 |
| InChIKey | IZJFVWFJQKBKHT-HQVZTVAUSA-N |
| XLogP | 0.57 |
| TPSA | 142.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.32 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|