C19H15N6NaO8S2 — CID 88598907
sodium (6S)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-[2-(5-nitrofuran-2-yl)ethenyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 88598907) has the molecular formula C19H15N6NaO8S2 and a molecular weight of 542.49 g/mol. Its IUPAC name is sodium (6S)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-[2-(5-nitrofuran-2-yl)ethenyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | sodium (6S)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-[2-(5-nitrofuran-2-yl)ethenyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 88598907 |
| Molecular Formula | C19H15N6NaO8S2 |
| Molecular Weight | 542.49 g/mol |
| Exact Mass | 542.03 |
| IUPAC Name | sodium (6S)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-[2-(5-nitrofuran-2-yl)ethenyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | CON=C(C(=O)NC1C(=O)N2C(C(=O)[O-])=C(C=Cc3ccc([N+](=O)[O-])o3)CS[C@@H]12)c1csc(N)n1.[Na+] |
| InChI | InChI=1S/C19H16N6O8S2.Na/c1-32-23-12(10-7-35-19(20)21-10)15(26)22-13-16(27)24-14(18(28)29)8(6-34-17(13)24)2-3-9-4-5-11(33-9)25(30)31;/h2-5,7,13,17H,6H2,1H3,(H2,20,21)(H,22,26)(H,28,29);/q;+1/p-1/t13?,17-;/m0./s1 |
| InChIKey | PQDAXKKPIWKRPU-LPQWCSLBSA-M |
| XLogP | -3.30 |
| TPSA | 206.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.49 |
| LogP ≤ 5 | -3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|