C19H16N6O8S2 — CID 88598759
(6R)-7-[[(2E)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-[(E)-2-(5-nitrofuran-2-yl)ethenyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 88598759) has the molecular formula C19H16N6O8S2 and a molecular weight of 520.51 g/mol. Its IUPAC name is (6R)-7-[[(2E)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-[(E)-2-(5-nitrofuran-2-yl)ethenyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6R)-7-[[(2E)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-[(E)-2-(5-nitrofuran-2-yl)ethenyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 88598759 |
| Molecular Formula | C19H16N6O8S2 |
| Molecular Weight | 520.51 g/mol |
| Exact Mass | 520.05 |
| IUPAC Name | (6R)-7-[[(2E)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-[(E)-2-(5-nitrofuran-2-yl)ethenyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | CO/N=C(/C(=O)NC1C(=O)N2C(C(=O)O)=C(/C=C/c3ccc([N+](=O)[O-])o3)CS[C@H]12)c1csc(N)n1 |
| InChI | InChI=1S/C19H16N6O8S2/c1-32-23-12(10-7-35-19(20)21-10)15(26)22-13-16(27)24-14(18(28)29)8(6-34-17(13)24)2-3-9-4-5-11(33-9)25(30)31/h2-5,7,13,17H,6H2,1H3,(H2,20,21)(H,22,26)(H,28,29)/b3-2+,23-12+/t13?,17-/m1/s1 |
| InChIKey | KVCAEPRRASDECY-MLIFRYAOSA-N |
| XLogP | 1.03 |
| TPSA | 203.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.51 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|