C20H24N4O6S2 — CID 54179051
2,2-dimethylpropanoyloxymethyl (6S,7R)-7-[2-(2-amino-1,3-thiazol-4-yl)but-2-enoylamino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 54179051) has the molecular formula C20H24N4O6S2 and a molecular weight of 480.57 g/mol. Its IUPAC name is 2,2-dimethylpropanoyloxymethyl (6S,7R)-7-[2-(2-amino-1,3-thiazol-4-yl)but-2-enoylamino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | 2,2-dimethylpropanoyloxymethyl (6S,7R)-7-[2-(2-amino-1,3-thiazol-4-yl)but-2-enoylamino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 54179051 |
| Molecular Formula | C20H24N4O6S2 |
| Molecular Weight | 480.57 g/mol |
| Exact Mass | 480.11 |
| IUPAC Name | 2,2-dimethylpropanoyloxymethyl (6S,7R)-7-[2-(2-amino-1,3-thiazol-4-yl)but-2-enoylamino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | CC=C(C(=O)N[C@@H]1C(=O)N2C(C(=O)OCOC(=O)C(C)(C)C)=CCS[C@@H]12)c1csc(N)n1 |
| InChI | InChI=1S/C20H24N4O6S2/c1-5-10(11-8-32-19(21)22-11)14(25)23-13-15(26)24-12(6-7-31-16(13)24)17(27)29-9-30-18(28)20(2,3)4/h5-6,8,13,16H,7,9H2,1-4H3,(H2,21,22)(H,23,25)/t13-,16+/m1/s1 |
| InChIKey | PANARGYERXUVMY-CJNGLKHVSA-N |
| XLogP | 1.50 |
| TPSA | 140.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.57 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|