C21H28ClN5O7S2 — CID 88712591
2,3-dimethylpentanoyloxymethyl (6S)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate;hydrochloride (PubChem CID 88712591) has the molecular formula C21H28ClN5O7S2 and a molecular weight of 562.07 g/mol. Its IUPAC name is 2,3-dimethylpentanoyloxymethyl (6S)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate;hydrochloride.
| Compound Name | 2,3-dimethylpentanoyloxymethyl (6S)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 88712591 |
| Molecular Formula | C21H28ClN5O7S2 |
| Molecular Weight | 562.07 g/mol |
| Exact Mass | 561.11 |
| IUPAC Name | 2,3-dimethylpentanoyloxymethyl (6S)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate;hydrochloride |
| SMILES | CCC(C)C(C)C(=O)OCOC(=O)C1=CCS[C@H]2C(NC(=O)C(=NOC)c3csc(N)n3)C(=O)N12.Cl |
| InChI | InChI=1S/C21H27N5O7S2.ClH/c1-5-10(2)11(3)19(29)32-9-33-20(30)13-6-7-34-18-15(17(28)26(13)18)24-16(27)14(25-31-4)12-8-35-21(22)23-12;/h6,8,10-11,15,18H,5,7,9H2,1-4H3,(H2,22,23)(H,24,27);1H/t10?,11?,15?,18-;/m0./s1 |
| InChIKey | XJWNSXDLUGYJFX-JOKIIWNUSA-N |
| XLogP | 1.51 |
| TPSA | 162.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.07 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|