C15H17N5O5S2 — CID 139906160
ethyl (6R)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 139906160) has the molecular formula C15H17N5O5S2 and a molecular weight of 411.47 g/mol. Its IUPAC name is ethyl (6R)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | ethyl (6R)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 139906160 |
| Molecular Formula | C15H17N5O5S2 |
| Molecular Weight | 411.47 g/mol |
| Exact Mass | 411.07 |
| IUPAC Name | ethyl (6R)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | CCOC(=O)C1=CCS[C@@H]2C(NC(=O)/C(=N\OC)c3csc(N)n3)C(=O)N12 |
| InChI | InChI=1S/C15H17N5O5S2/c1-3-25-14(23)8-4-5-26-13-10(12(22)20(8)13)18-11(21)9(19-24-2)7-6-27-15(16)17-7/h4,6,10,13H,3,5H2,1-2H3,(H2,16,17)(H,18,21)/b19-9-/t10?,13-/m1/s1 |
| InChIKey | NLBPUUJULIIFER-HGAOWNCASA-N |
| XLogP | -0.08 |
| TPSA | 136.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.47 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|