C17H19N5O8S2 — CID 88702677
1-ethoxycarbonyloxyethyl (6S)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 88702677) has the molecular formula C17H19N5O8S2 and a molecular weight of 485.50 g/mol. Its IUPAC name is 1-ethoxycarbonyloxyethyl (6S)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | 1-ethoxycarbonyloxyethyl (6S)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 88702677 |
| Molecular Formula | C17H19N5O8S2 |
| Molecular Weight | 485.50 g/mol |
| Exact Mass | 485.07 |
| IUPAC Name | 1-ethoxycarbonyloxyethyl (6S)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | CCOC(=O)OC(C)OC(=O)C1=CCS[C@H]2C(NC(=O)C(=NO)c3csc(N)n3)C(=O)N12 |
| InChI | InChI=1S/C17H19N5O8S2/c1-3-28-17(26)30-7(2)29-15(25)9-4-5-31-14-11(13(24)22(9)14)20-12(23)10(21-27)8-6-32-16(18)19-8/h4,6-7,11,14,27H,3,5H2,1-2H3,(H2,18,19)(H,20,23)/t7?,11?,14-/m0/s1 |
| InChIKey | IBLFAUONYOYZFK-YYUZOUMRSA-N |
| XLogP | 0.25 |
| TPSA | 182.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.50 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|