C12H11N5O5S2 — CID 88626265
(6S)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 88626265) has the molecular formula C12H11N5O5S2 and a molecular weight of 369.38 g/mol. Its IUPAC name is (6S)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6S)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 88626265 |
| Molecular Formula | C12H11N5O5S2 |
| Molecular Weight | 369.38 g/mol |
| Exact Mass | 369.02 |
| IUPAC Name | (6S)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | Nc1nc(/C(=N/O)C(=O)NC2C(=O)N3C(C(=O)O)=CCS[C@@H]23)cs1 |
| InChI | InChI=1S/C12H11N5O5S2/c13-12-14-4(3-24-12)6(16-22)8(18)15-7-9(19)17-5(11(20)21)1-2-23-10(7)17/h1,3,7,10,22H,2H2,(H2,13,14)(H,15,18)(H,20,21)/b16-6-/t7?,10-/m0/s1 |
| InChIKey | QRGJJTYSPCXVCW-GEKHIJMNSA-N |
| XLogP | -0.73 |
| TPSA | 158.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.38 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|