C18H19N5O7S2 — CID 139604952
1-(cyclopropanecarbonyloxy)ethyl (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 139604952) has the molecular formula C18H19N5O7S2 and a molecular weight of 481.51 g/mol. Its IUPAC name is 1-(cyclopropanecarbonyloxy)ethyl (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | 1-(cyclopropanecarbonyloxy)ethyl (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 139604952 |
| Molecular Formula | C18H19N5O7S2 |
| Molecular Weight | 481.51 g/mol |
| Exact Mass | 481.07 |
| IUPAC Name | 1-(cyclopropanecarbonyloxy)ethyl (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | CC(OC(=O)C1=CCS[C@@H]2C(NC(=O)C(=NO)c3csc(N)n3)C(=O)N12)OC(=O)C1CC1 |
| InChI | InChI=1S/C18H19N5O7S2/c1-7(29-16(26)8-2-3-8)30-17(27)10-4-5-31-15-12(14(25)23(10)15)21-13(24)11(22-28)9-6-32-18(19)20-9/h4,6-8,12,15,28H,2-3,5H2,1H3,(H2,19,20)(H,21,24)/t7?,12?,15-/m1/s1 |
| InChIKey | ZXLXLYAABIHDAC-UUXVJNKCSA-N |
| XLogP | 0.03 |
| TPSA | 173.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.51 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|