C19H21N5O7S2 — CID 88624805
1-propanoyloxyethyl (6S)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 88624805) has the molecular formula C19H21N5O7S2 and a molecular weight of 495.54 g/mol. Its IUPAC name is 1-propanoyloxyethyl (6S)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | 1-propanoyloxyethyl (6S)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 88624805 |
| Molecular Formula | C19H21N5O7S2 |
| Molecular Weight | 495.54 g/mol |
| Exact Mass | 495.09 |
| IUPAC Name | 1-propanoyloxyethyl (6S)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | C=CC1=C(C(=O)OC(C)OC(=O)CC)N2C(=O)C(NC(=O)C(=NO)c3csc(N)n3)[C@@H]2SC1 |
| InChI | InChI=1S/C19H21N5O7S2/c1-4-9-6-32-17-13(22-15(26)12(23-29)10-7-33-19(20)21-10)16(27)24(17)14(9)18(28)31-8(3)30-11(25)5-2/h4,7-8,13,17,29H,1,5-6H2,2-3H3,(H2,20,21)(H,22,26)/t8?,13?,17-/m0/s1 |
| InChIKey | SOZUYYMGBRMUHY-XFWWCRMGSA-N |
| XLogP | 0.59 |
| TPSA | 173.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.54 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|