C21H23N5O9S2 — CID 88618874
1-acetyloxyethyl (6S,7R)-3-[(E)-3-acetyloxyprop-1-enyl]-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 88618874) has the molecular formula C21H23N5O9S2 and a molecular weight of 553.58 g/mol. Its IUPAC name is 1-acetyloxyethyl (6S,7R)-3-[(E)-3-acetyloxyprop-1-enyl]-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | 1-acetyloxyethyl (6S,7R)-3-[(E)-3-acetyloxyprop-1-enyl]-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 88618874 |
| Molecular Formula | C21H23N5O9S2 |
| Molecular Weight | 553.58 g/mol |
| Exact Mass | 553.09 |
| IUPAC Name | 1-acetyloxyethyl (6S,7R)-3-[(E)-3-acetyloxyprop-1-enyl]-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | CC(=O)OC/C=C/C1=C(C(=O)OC(C)OC(C)=O)N2C(=O)[C@@H](NC(=O)/C(=N\O)c3csc(N)n3)[C@@H]2SC1 |
| InChI | InChI=1S/C21H23N5O9S2/c1-9(27)33-6-4-5-12-7-36-19-15(24-17(29)14(25-32)13-8-37-21(22)23-13)18(30)26(19)16(12)20(31)35-11(3)34-10(2)28/h4-5,8,11,15,19,32H,6-7H2,1-3H3,(H2,22,23)(H,24,29)/b5-4+,25-14-/t11?,15-,19+/m1/s1 |
| InChIKey | WRHGKTBETYOFCY-LMCHCQJLSA-N |
| XLogP | 0.13 |
| TPSA | 199.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.58 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|