C22H27N5O7S2 — CID 88670091
1-acetyloxyethyl (6R,7R)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-propan-2-yloxyiminoacetyl]amino]-8-oxo-3-[(Z)-prop-1-enyl]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 88670091) has the molecular formula C22H27N5O7S2 and a molecular weight of 537.62 g/mol. Its IUPAC name is 1-acetyloxyethyl (6R,7R)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-propan-2-yloxyiminoacetyl]amino]-8-oxo-3-[(Z)-prop-1-enyl]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | 1-acetyloxyethyl (6R,7R)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-propan-2-yloxyiminoacetyl]amino]-8-oxo-3-[(Z)-prop-1-enyl]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 88670091 |
| Molecular Formula | C22H27N5O7S2 |
| Molecular Weight | 537.62 g/mol |
| Exact Mass | 537.14 |
| IUPAC Name | 1-acetyloxyethyl (6R,7R)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-propan-2-yloxyiminoacetyl]amino]-8-oxo-3-[(Z)-prop-1-enyl]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | C/C=C\C1=C(C(=O)OC(C)OC(C)=O)N2C(=O)[C@@H](NC(=O)/C(=N\OC(C)C)c3csc(N)n3)[C@H]2SC1 |
| InChI | InChI=1S/C22H27N5O7S2/c1-6-7-13-8-35-20-16(19(30)27(20)17(13)21(31)33-12(5)32-11(4)28)25-18(29)15(26-34-10(2)3)14-9-36-22(23)24-14/h6-7,9-10,12,16,20H,8H2,1-5H3,(H2,23,24)(H,25,29)/b7-6-,26-15-/t12?,16-,20-/m1/s1 |
| InChIKey | BLIHHCPAKKRSAZ-RUYWGTJJSA-N |
| XLogP | 1.54 |
| TPSA | 162.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.62 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|