C21H25N5O8S2 — CID 54025066
[(1S)-1-acetyloxyethyl] (6R,7R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-3-(oxolan-2-yl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 54025066) has the molecular formula C21H25N5O8S2 and a molecular weight of 539.59 g/mol. Its IUPAC name is [(1S)-1-acetyloxyethyl] (6R,7R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-3-(oxolan-2-yl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | [(1S)-1-acetyloxyethyl] (6R,7R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-3-(oxolan-2-yl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 54025066 |
| Molecular Formula | C21H25N5O8S2 |
| Molecular Weight | 539.59 g/mol |
| Exact Mass | 539.11 |
| IUPAC Name | [(1S)-1-acetyloxyethyl] (6R,7R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-3-(oxolan-2-yl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | CON=C(C(=O)N[C@@H]1C(=O)N2C(C(=O)O[C@@H](C)OC(C)=O)=C(C3CCCO3)CS[C@H]12)c1csc(N)n1 |
| InChI | InChI=1S/C21H25N5O8S2/c1-9(27)33-10(2)34-20(30)16-11(13-5-4-6-32-13)7-35-19-15(18(29)26(16)19)24-17(28)14(25-31-3)12-8-36-21(22)23-12/h8,10,13,15,19H,4-7H2,1-3H3,(H2,22,23)(H,24,28)/t10-,13?,15+,19+/m0/s1 |
| InChIKey | LBPUIYRRWJFLTR-XWTORUIISA-N |
| XLogP | 0.36 |
| TPSA | 171.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.59 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|