C18H22N6O6S2 — CID 10435364
7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-[(5S)-2,2-dimethyl-1,2-oxazolidin-2-ium-5-yl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 10435364) has the molecular formula C18H22N6O6S2 and a molecular weight of 482.54 g/mol. Its IUPAC name is 7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-[(5S)-2,2-dimethyl-1,2-oxazolidin-2-ium-5-yl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | 7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-[(5S)-2,2-dimethyl-1,2-oxazolidin-2-ium-5-yl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 10435364 |
| Molecular Formula | C18H22N6O6S2 |
| Molecular Weight | 482.54 g/mol |
| Exact Mass | 482.10 |
| IUPAC Name | 7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-[(5S)-2,2-dimethyl-1,2-oxazolidin-2-ium-5-yl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | CO/N=C(\C(=O)NC1C(=O)N2C(C(=O)[O-])=C([C@@H]3CC[N+](C)(C)O3)CSC12)c1csc(N)n1 |
| InChI | InChI=1S/C18H22N6O6S2/c1-24(2)5-4-10(30-24)8-6-31-16-12(15(26)23(16)13(8)17(27)28)21-14(25)11(22-29-3)9-7-32-18(19)20-9/h7,10,12,16H,4-6H2,1-3H3,(H3-,19,20,21,25,27,28)/b22-11-/t10-,12?,16?/m0/s1 |
| InChIKey | YWCNTWKUYLGLBK-GRPFINAMSA-N |
| XLogP | -1.74 |
| TPSA | 159.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.54 |
| LogP ≤ 5 | -1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|