C17H18N5NaO5S3 — CID 131718575
sodium (6R)-7-[[(2E)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-3-(oxolan-3-yl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carbothioate (PubChem CID 131718575) has the molecular formula C17H18N5NaO5S3 and a molecular weight of 491.55 g/mol. Its IUPAC name is sodium (6R)-7-[[(2E)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-3-(oxolan-3-yl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carbothioate.
| Compound Name | sodium (6R)-7-[[(2E)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-3-(oxolan-3-yl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carbothioate |
|---|---|
| PubChem CID | 131718575 |
| Molecular Formula | C17H18N5NaO5S3 |
| Molecular Weight | 491.55 g/mol |
| Exact Mass | 491.04 |
| IUPAC Name | sodium (6R)-7-[[(2E)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-3-(oxolan-3-yl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carbothioate |
| SMILES | CO/N=C(/C(=O)NC1C(=O)N2C(C([O-])=S)=C(C3CCOC3)CS[C@H]12)c1csc(N)n1.[Na+] |
| InChI | InChI=1S/C17H19N5O5S3.Na/c1-26-21-10(9-6-30-17(18)19-9)13(23)20-11-14(24)22-12(16(25)28)8(5-29-15(11)22)7-2-3-27-4-7;/h6-7,11,15H,2-5H2,1H3,(H2,18,19)(H,20,23)(H,25,28);/q;+1/p-1/b21-10+;/t7?,11?,15-;/m1./s1 |
| InChIKey | SUAHRHJWLLRTPO-OSNAWLILSA-M |
| XLogP | -3.54 |
| TPSA | 142.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.55 |
| LogP ≤ 5 | -3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|