C17H18N7NaO6S3 — CID 139763126
sodium (6R)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-[2-(oxamoylamino)ethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carbothioate (PubChem CID 139763126) has the molecular formula C17H18N7NaO6S3 and a molecular weight of 535.57 g/mol. Its IUPAC name is sodium (6R)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-[2-(oxamoylamino)ethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carbothioate.
| Compound Name | sodium (6R)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-[2-(oxamoylamino)ethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carbothioate |
|---|---|
| PubChem CID | 139763126 |
| Molecular Formula | C17H18N7NaO6S3 |
| Molecular Weight | 535.57 g/mol |
| Exact Mass | 535.04 |
| IUPAC Name | sodium (6R)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-[2-(oxamoylamino)ethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carbothioate |
| SMILES | CO/N=C(\C(=O)NC1C(=O)N2C(C([O-])=S)=C(CCNC(=O)C(N)=O)CS[C@H]12)c1csc(N)n1.[Na+] |
| InChI | InChI=1S/C17H19N7O6S3.Na/c1-30-23-8(7-5-33-17(19)21-7)12(26)22-9-14(28)24-10(16(29)31)6(4-32-15(9)24)2-3-20-13(27)11(18)25;/h5,9,15H,2-4H2,1H3,(H2,18,25)(H2,19,21)(H,20,27)(H,22,26)(H,29,31);/q;+1/p-1/b23-8-;/t9?,15-;/m1./s1 |
| InChIKey | ILOSSBPUCJAFTC-XROJNWLMSA-M |
| XLogP | -5.59 |
| TPSA | 205.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.57 |
| LogP ≤ 5 | -5.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|