C14H14IN5O5S2 — CID 54525688
(6S)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-(iodomethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 54525688) has the molecular formula C14H14IN5O5S2 and a molecular weight of 523.33 g/mol. Its IUPAC name is (6S)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-(iodomethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6S)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-(iodomethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 54525688 |
| Molecular Formula | C14H14IN5O5S2 |
| Molecular Weight | 523.33 g/mol |
| Exact Mass | 522.95 |
| IUPAC Name | (6S)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-(iodomethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | CON=C(C(=O)NC1C(=O)N2C(C(=O)O)=C(CI)CS[C@@H]12)c1csc(N)n1 |
| InChI | InChI=1S/C14H14IN5O5S2/c1-25-19-7(6-4-27-14(16)17-6)10(21)18-8-11(22)20-9(13(23)24)5(2-15)3-26-12(8)20/h4,8,12H,2-3H2,1H3,(H2,16,17)(H,18,21)(H,23,24)/t8?,12-/m0/s1 |
| InChIKey | YSYLGOIGKGZHSL-MYIOLCAUSA-N |
| XLogP | 0.25 |
| TPSA | 147.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.33 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|