C21H19N5O6S3 — CID 53374929
(7R)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-(benzoylsulfanylmethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 53374929) has the molecular formula C21H19N5O6S3 and a molecular weight of 533.61 g/mol. Its IUPAC name is (7R)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-(benzoylsulfanylmethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (7R)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-(benzoylsulfanylmethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 53374929 |
| Molecular Formula | C21H19N5O6S3 |
| Molecular Weight | 533.61 g/mol |
| Exact Mass | 533.05 |
| IUPAC Name | (7R)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-(benzoylsulfanylmethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | CO/N=C(\C(=O)N[C@@H]1C(=O)N2C(C(=O)O)=C(CSC(=O)c3ccccc3)CSC12)c1csc(N)n1 |
| InChI | InChI=1S/C21H19N5O6S3/c1-32-25-13(12-9-35-21(22)23-12)16(27)24-14-17(28)26-15(19(29)30)11(7-33-18(14)26)8-34-20(31)10-5-3-2-4-6-10/h2-6,9,14,18H,7-8H2,1H3,(H2,22,23)(H,24,27)(H,29,30)/b25-13-/t14-,18?/m1/s1 |
| InChIKey | NJSZNXJSLMMJAD-KLFGIQFPSA-N |
| XLogP | 1.39 |
| TPSA | 164.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.61 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|