C21H19N5O6S2 — CID 88700880
7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-3-phenacyl-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 88700880) has the molecular formula C21H19N5O6S2 and a molecular weight of 501.55 g/mol. Its IUPAC name is 7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-3-phenacyl-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | 7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-3-phenacyl-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 88700880 |
| Molecular Formula | C21H19N5O6S2 |
| Molecular Weight | 501.55 g/mol |
| Exact Mass | 501.08 |
| IUPAC Name | 7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-3-phenacyl-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | CO/N=C(\C(=O)NC1C(=O)N2C(C(=O)O)=C(CC(=O)c3ccccc3)CSC12)c1csc(N)n1 |
| InChI | InChI=1S/C21H19N5O6S2/c1-32-25-14(12-9-34-21(22)23-12)17(28)24-15-18(29)26-16(20(30)31)11(8-33-19(15)26)7-13(27)10-5-3-2-4-6-10/h2-6,9,15,19H,7-8H2,1H3,(H2,22,23)(H,24,28)(H,30,31)/b25-14- |
| InChIKey | VALBJQDDLQXCQG-QFEZKATASA-N |
| XLogP | 1.09 |
| TPSA | 164.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.55 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|