C15H16KN5O5S2 — CID 172956086
potassium;7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate;methane (PubChem CID 172956086) has the molecular formula C15H16KN5O5S2 and a molecular weight of 449.56 g/mol. Its IUPAC name is potassium;7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate;methane.
| Compound Name | potassium;7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate;methane |
|---|---|
| PubChem CID | 172956086 |
| Molecular Formula | C15H16KN5O5S2 |
| Molecular Weight | 449.56 g/mol |
| Exact Mass | 449.02 |
| IUPAC Name | potassium;7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate;methane |
| SMILES | C.C=CC1=C(C(=O)[O-])N2C(=O)C(NC(=O)/C(=N\O)c3csc(N)n3)C2SC1.[K+] |
| InChI | InChI=1S/C14H13N5O5S2.CH4.K/c1-2-5-3-25-12-8(11(21)19(12)9(5)13(22)23)17-10(20)7(18-24)6-4-26-14(15)16-6;;/h2,4,8,12,24H,1,3H2,(H2,15,16)(H,17,20)(H,22,23);1H4;/q;;+1/p-1/b18-7-;; |
| InChIKey | QPAWQOXKMVHDHN-UDONAEJHSA-M |
| XLogP | -3.87 |
| TPSA | 161.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.56 |
| LogP ≤ 5 | -3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|