C33H26KN5O5S2 — CID 87506869
potassium (6R,7R)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-trityloxyiminoacetyl]amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 87506869) has the molecular formula C33H26KN5O5S2 and a molecular weight of 675.83 g/mol. Its IUPAC name is potassium (6R,7R)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-trityloxyiminoacetyl]amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | potassium (6R,7R)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-trityloxyiminoacetyl]amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 87506869 |
| Molecular Formula | C33H26KN5O5S2 |
| Molecular Weight | 675.83 g/mol |
| Exact Mass | 675.10 |
| IUPAC Name | potassium (6R,7R)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-trityloxyiminoacetyl]amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | C=CC1=C(C(=O)[O-])N2C(=O)[C@@H](NC(=O)/C(=N\OC(c3ccccc3)(c3ccccc3)c3ccccc3)c3csc(N)n3)[C@H]2SC1.[K+] |
| InChI | InChI=1S/C33H27N5O5S2.K/c1-2-20-18-44-30-26(29(40)38(30)27(20)31(41)42)36-28(39)25(24-19-45-32(34)35-24)37-43-33(21-12-6-3-7-13-21,22-14-8-4-9-15-22)23-16-10-5-11-17-23;/h2-17,19,26,30H,1,18H2,(H2,34,35)(H,36,39)(H,41,42);/q;+1/p-1/b37-25-;/t26-,30-;/m1./s1 |
| InChIKey | RYAQSJNEONEOJA-JWNNYCIBSA-M |
| XLogP | 0.03 |
| TPSA | 150.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.83 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|