C14H12KN5O5S2 — CID 71623606
potassium (7R)-7-[[(2E)-2-(2-amino-1,3-thiazol-5-yl)-2-hydroxyiminoacetyl]amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 71623606) has the molecular formula C14H12KN5O5S2 and a molecular weight of 433.51 g/mol. Its IUPAC name is potassium (7R)-7-[[(2E)-2-(2-amino-1,3-thiazol-5-yl)-2-hydroxyiminoacetyl]amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | potassium (7R)-7-[[(2E)-2-(2-amino-1,3-thiazol-5-yl)-2-hydroxyiminoacetyl]amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 71623606 |
| Molecular Formula | C14H12KN5O5S2 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 432.99 |
| IUPAC Name | potassium (7R)-7-[[(2E)-2-(2-amino-1,3-thiazol-5-yl)-2-hydroxyiminoacetyl]amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | C=CC1=C(C(=O)[O-])N2C(=O)[C@@H](NC(=O)/C(=N\O)c3cnc(N)s3)C2SC1.[K+] |
| InChI | InChI=1S/C14H13N5O5S2.K/c1-2-5-4-25-12-8(11(21)19(12)9(5)13(22)23)17-10(20)7(18-24)6-3-16-14(15)26-6;/h2-3,8,12,24H,1,4H2,(H2,15,16)(H,17,20)(H,22,23);/q;+1/p-1/b18-7-;/t8-,12?;/m1./s1 |
| InChIKey | HEPCRASRYNEEAL-XKTNXZJSSA-M |
| XLogP | -4.50 |
| TPSA | 161.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | -4.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|