C14H15KN5O9PS2 — CID 173491231
potassium;(6R,7R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid;dihydrogen phosphate (PubChem CID 173491231) has the molecular formula C14H15KN5O9PS2 and a molecular weight of 531.51 g/mol. Its IUPAC name is potassium;(6R,7R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid;dihydrogen phosphate.
| Compound Name | potassium;(6R,7R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid;dihydrogen phosphate |
|---|---|
| PubChem CID | 173491231 |
| Molecular Formula | C14H15KN5O9PS2 |
| Molecular Weight | 531.51 g/mol |
| Exact Mass | 530.97 |
| IUPAC Name | potassium;(6R,7R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid;dihydrogen phosphate |
| SMILES | C=CC1=C(C(=O)O)N2C(=O)[C@@H](NC(=O)C(=NO)c3csc(N)n3)[C@H]2SC1.O=P([O-])(O)O.[K+] |
| InChI | InChI=1S/C14H13N5O5S2.K.H3O4P/c1-2-5-3-25-12-8(11(21)19(12)9(5)13(22)23)17-10(20)7(18-24)6-4-26-14(15)16-6;;1-5(2,3)4/h2,4,8,12,24H,1,3H2,(H2,15,16)(H,17,20)(H,22,23);;(H3,1,2,3,4)/q;+1;/p-1/t8-,12-;;/m1../s1 |
| InChIKey | ONBQMWNGCAWJHY-ZEDOPEAVSA-M |
| XLogP | -4.73 |
| TPSA | 238.80 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.51 |
| LogP ≤ 5 | -4.73 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|