C17H17N7O5S2 — CID 11655594
(7R)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid;1H-imidazole (PubChem CID 11655594) has the molecular formula C17H17N7O5S2 and a molecular weight of 463.50 g/mol. Its IUPAC name is (7R)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid;1H-imidazole.
| Compound Name | (7R)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid;1H-imidazole |
|---|---|
| PubChem CID | 11655594 |
| Molecular Formula | C17H17N7O5S2 |
| Molecular Weight | 463.50 g/mol |
| Exact Mass | 463.07 |
| IUPAC Name | (7R)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid;1H-imidazole |
| SMILES | C=CC1=C(C(=O)O)N2C(=O)[C@@H](NC(=O)/C(=N\O)c3csc(N)n3)C2SC1.c1c[nH]cn1 |
| InChI | InChI=1S/C14H13N5O5S2.C3H4N2/c1-2-5-3-25-12-8(11(21)19(12)9(5)13(22)23)17-10(20)7(18-24)6-4-26-14(15)16-6;1-2-5-3-4-1/h2,4,8,12,24H,1,3H2,(H2,15,16)(H,17,20)(H,22,23);1-3H,(H,4,5)/b18-7-;/t8-,12?;/m1./s1 |
| InChIKey | NJXPYIWTCYOWHV-XKTNXZJSSA-N |
| XLogP | 0.24 |
| TPSA | 186.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.50 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|