C19H24ClN5O8S2 — CID 88712691
1-propan-2-yloxycarbonyloxyethyl (6R)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate;hydrochloride (PubChem CID 88712691) has the molecular formula C19H24ClN5O8S2 and a molecular weight of 550.02 g/mol. Its IUPAC name is 1-propan-2-yloxycarbonyloxyethyl (6R)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate;hydrochloride.
| Compound Name | 1-propan-2-yloxycarbonyloxyethyl (6R)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 88712691 |
| Molecular Formula | C19H24ClN5O8S2 |
| Molecular Weight | 550.02 g/mol |
| Exact Mass | 549.08 |
| IUPAC Name | 1-propan-2-yloxycarbonyloxyethyl (6R)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate;hydrochloride |
| SMILES | CO/N=C(\C(=O)NC1C(=O)N2C(C(=O)OC(C)OC(=O)OC(C)C)=CCS[C@H]12)c1csc(N)n1.Cl |
| InChI | InChI=1S/C19H23N5O8S2.ClH/c1-8(2)30-19(28)32-9(3)31-17(27)11-5-6-33-16-13(15(26)24(11)16)22-14(25)12(23-29-4)10-7-34-18(20)21-10;/h5,7-9,13,16H,6H2,1-4H3,(H2,20,21)(H,22,25);1H/b23-12-;/t9?,13?,16-;/m1./s1 |
| InChIKey | ARDHQGFUSVCLGE-SDZTXELPSA-N |
| XLogP | 1.23 |
| TPSA | 171.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.02 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|