C37H35N5O8S2 — CID 88755500
1-ethoxycarbonyloxyethyl (6R)-7-[[(2Z)-2-methoxyimino-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 88755500) has the molecular formula C37H35N5O8S2 and a molecular weight of 741.85 g/mol. Its IUPAC name is 1-ethoxycarbonyloxyethyl (6R)-7-[[(2Z)-2-methoxyimino-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | 1-ethoxycarbonyloxyethyl (6R)-7-[[(2Z)-2-methoxyimino-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 88755500 |
| Molecular Formula | C37H35N5O8S2 |
| Molecular Weight | 741.85 g/mol |
| Exact Mass | 741.19 |
| IUPAC Name | 1-ethoxycarbonyloxyethyl (6R)-7-[[(2Z)-2-methoxyimino-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | CCOC(=O)OC(C)OC(=O)C1=CCS[C@@H]2C(NC(=O)/C(=N\OC)c3csc(NC(c4ccccc4)(c4ccccc4)c4ccccc4)n3)C(=O)N12 |
| InChI | InChI=1S/C37H35N5O8S2/c1-4-48-36(46)50-23(2)49-34(45)28-20-21-51-33-30(32(44)42(28)33)39-31(43)29(41-47-3)27-22-52-35(38-27)40-37(24-14-8-5-9-15-24,25-16-10-6-11-17-25)26-18-12-7-13-19-26/h5-20,22-23,30,33H,4,21H2,1-3H3,(H,38,40)(H,39,43)/b41-29-/t23?,30?,33-/m1/s1 |
| InChIKey | KBPICMWTSRYFTI-FTZDZALVSA-N |
| XLogP | 5.24 |
| TPSA | 157.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.85 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|