C21H26N4O6S2 — CID 154413349
2,2-dimethylpropanoyloxymethyl (6R,7R)-7-[2-(2-amino-1,3-thiazol-4-yl)pent-2-enoylamino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 154413349) has the molecular formula C21H26N4O6S2 and a molecular weight of 494.60 g/mol. Its IUPAC name is 2,2-dimethylpropanoyloxymethyl (6R,7R)-7-[2-(2-amino-1,3-thiazol-4-yl)pent-2-enoylamino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | 2,2-dimethylpropanoyloxymethyl (6R,7R)-7-[2-(2-amino-1,3-thiazol-4-yl)pent-2-enoylamino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 154413349 |
| Molecular Formula | C21H26N4O6S2 |
| Molecular Weight | 494.60 g/mol |
| Exact Mass | 494.13 |
| IUPAC Name | 2,2-dimethylpropanoyloxymethyl (6R,7R)-7-[2-(2-amino-1,3-thiazol-4-yl)pent-2-enoylamino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | CCC=C(C(=O)N[C@@H]1C(=O)N2C(C(=O)OCOC(=O)C(C)(C)C)=CCS[C@H]12)c1csc(N)n1 |
| InChI | InChI=1S/C21H26N4O6S2/c1-5-6-11(12-9-33-20(22)23-12)15(26)24-14-16(27)25-13(7-8-32-17(14)25)18(28)30-10-31-19(29)21(2,3)4/h6-7,9,14,17H,5,8,10H2,1-4H3,(H2,22,23)(H,24,26)/t14-,17-/m1/s1 |
| InChIKey | AVGFNYXUZHCJEI-RHSMWYFYSA-N |
| XLogP | 1.89 |
| TPSA | 140.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.60 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|