C28H36N4O9S — CID 18599208
tert-butyl (6R,7R)-3-[acetyloxy-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-phenylacetyl]amino]methyl]-7-formamido-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 18599208) has the molecular formula C28H36N4O9S and a molecular weight of 604.68 g/mol. Its IUPAC name is tert-butyl (6R,7R)-3-[acetyloxy-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-phenylacetyl]amino]methyl]-7-formamido-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | tert-butyl (6R,7R)-3-[acetyloxy-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-phenylacetyl]amino]methyl]-7-formamido-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 18599208 |
| Molecular Formula | C28H36N4O9S |
| Molecular Weight | 604.68 g/mol |
| Exact Mass | 604.22 |
| IUPAC Name | tert-butyl (6R,7R)-3-[acetyloxy-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-phenylacetyl]amino]methyl]-7-formamido-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | CC(=O)OC(NC(=O)C(NC(=O)OC(C)(C)C)c1ccccc1)C1=C(C(=O)OC(C)(C)C)N2C(=O)[C@@H](NC=O)[C@H]2SC1 |
| InChI | InChI=1S/C28H36N4O9S/c1-15(34)39-22(31-21(35)18(16-11-9-8-10-12-16)30-26(38)41-28(5,6)7)17-13-42-24-19(29-14-33)23(36)32(24)20(17)25(37)40-27(2,3)4/h8-12,14,18-19,22,24H,13H2,1-7H3,(H,29,33)(H,30,38)(H,31,35)/t18?,19-,22?,24-/m1/s1 |
| InChIKey | PQWBVIXETDEXDM-KJVFQHSASA-N |
| XLogP | 1.88 |
| TPSA | 169.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.68 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|