C32H31N5O8S2 — CID 88671657
benzhydryl (6S)-7-[[2-(2-formamido-1,3-thiazol-4-yl)-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]iminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 88671657) has the molecular formula C32H31N5O8S2 and a molecular weight of 677.76 g/mol. Its IUPAC name is benzhydryl (6S)-7-[[2-(2-formamido-1,3-thiazol-4-yl)-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]iminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | benzhydryl (6S)-7-[[2-(2-formamido-1,3-thiazol-4-yl)-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]iminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 88671657 |
| Molecular Formula | C32H31N5O8S2 |
| Molecular Weight | 677.76 g/mol |
| Exact Mass | 677.16 |
| IUPAC Name | benzhydryl (6S)-7-[[2-(2-formamido-1,3-thiazol-4-yl)-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]iminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)CON=C(C(=O)NC1C(=O)N2C(C(=O)OC(c3ccccc3)c3ccccc3)=CCS[C@@H]12)c1csc(NC=O)n1 |
| InChI | InChI=1S/C32H31N5O8S2/c1-32(2,3)45-23(39)16-43-36-24(21-17-47-31(34-21)33-18-38)27(40)35-25-28(41)37-22(14-15-46-29(25)37)30(42)44-26(19-10-6-4-7-11-19)20-12-8-5-9-13-20/h4-14,17-18,25-26,29H,15-16H2,1-3H3,(H,35,40)(H,33,34,38)/t25?,29-/m0/s1 |
| InChIKey | YKUGPIAPVKZUBR-QFCCLOIZSA-N |
| XLogP | 3.39 |
| TPSA | 165.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.76 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|