C15H13N5O8S2 — CID 88607950
(6R)-7-[[(2E)-2-(carboxymethoxyimino)-2-(2-formamido-1,3-thiazol-4-yl)acetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 88607950) has the molecular formula C15H13N5O8S2 and a molecular weight of 455.43 g/mol. Its IUPAC name is (6R)-7-[[(2E)-2-(carboxymethoxyimino)-2-(2-formamido-1,3-thiazol-4-yl)acetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6R)-7-[[(2E)-2-(carboxymethoxyimino)-2-(2-formamido-1,3-thiazol-4-yl)acetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 88607950 |
| Molecular Formula | C15H13N5O8S2 |
| Molecular Weight | 455.43 g/mol |
| Exact Mass | 455.02 |
| IUPAC Name | (6R)-7-[[(2E)-2-(carboxymethoxyimino)-2-(2-formamido-1,3-thiazol-4-yl)acetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | O=CNc1nc(/C(=N\OCC(=O)O)C(=O)NC2C(=O)N3C(C(=O)O)=CCS[C@H]23)cs1 |
| InChI | InChI=1S/C15H13N5O8S2/c21-5-16-15-17-6(4-30-15)9(19-28-3-8(22)23)11(24)18-10-12(25)20-7(14(26)27)1-2-29-13(10)20/h1,4-5,10,13H,2-3H2,(H,18,24)(H,22,23)(H,26,27)(H,16,17,21)/b19-9+/t10?,13-/m1/s1 |
| InChIKey | ZMEZBWBWNZVEOP-BQTNOSBKSA-N |
| XLogP | -1.11 |
| TPSA | 187.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.43 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|