C15H12N6O6S2 — CID 88690270
(6R)-7-[[(2E)-2-(cyanomethoxyimino)-2-(2-formamido-1,3-thiazol-4-yl)acetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 88690270) has the molecular formula C15H12N6O6S2 and a molecular weight of 436.43 g/mol. Its IUPAC name is (6R)-7-[[(2E)-2-(cyanomethoxyimino)-2-(2-formamido-1,3-thiazol-4-yl)acetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6R)-7-[[(2E)-2-(cyanomethoxyimino)-2-(2-formamido-1,3-thiazol-4-yl)acetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 88690270 |
| Molecular Formula | C15H12N6O6S2 |
| Molecular Weight | 436.43 g/mol |
| Exact Mass | 436.03 |
| IUPAC Name | (6R)-7-[[(2E)-2-(cyanomethoxyimino)-2-(2-formamido-1,3-thiazol-4-yl)acetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | N#CCO/N=C(/C(=O)NC1C(=O)N2C(C(=O)O)=CCS[C@H]12)c1csc(NC=O)n1 |
| InChI | InChI=1S/C15H12N6O6S2/c16-2-3-27-20-9(7-5-29-15(18-7)17-6-22)11(23)19-10-12(24)21-8(14(25)26)1-4-28-13(10)21/h1,5-6,10,13H,3-4H2,(H,19,23)(H,25,26)(H,17,18,22)/b20-9+/t10?,13-/m1/s1 |
| InChIKey | LLFODJPPZRLZQP-XVPILCJGSA-N |
| XLogP | -0.68 |
| TPSA | 174.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.43 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|