C16H15N5O8S2 — CID 88690485
(6R)-7-[[(2Z)-2-(2-formamido-1,3-thiazol-4-yl)-2-(2-formyloxyethoxyimino)acetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 88690485) has the molecular formula C16H15N5O8S2 and a molecular weight of 469.46 g/mol. Its IUPAC name is (6R)-7-[[(2Z)-2-(2-formamido-1,3-thiazol-4-yl)-2-(2-formyloxyethoxyimino)acetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6R)-7-[[(2Z)-2-(2-formamido-1,3-thiazol-4-yl)-2-(2-formyloxyethoxyimino)acetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 88690485 |
| Molecular Formula | C16H15N5O8S2 |
| Molecular Weight | 469.46 g/mol |
| Exact Mass | 469.04 |
| IUPAC Name | (6R)-7-[[(2Z)-2-(2-formamido-1,3-thiazol-4-yl)-2-(2-formyloxyethoxyimino)acetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | O=CNc1nc(/C(=N/OCCOC=O)C(=O)NC2C(=O)N3C(C(=O)O)=CCS[C@H]23)cs1 |
| InChI | InChI=1S/C16H15N5O8S2/c22-6-17-16-18-8(5-31-16)10(20-29-3-2-28-7-23)12(24)19-11-13(25)21-9(15(26)27)1-4-30-14(11)21/h1,5-7,11,14H,2-4H2,(H,19,24)(H,26,27)(H,17,18,22)/b20-10-/t11?,14-/m1/s1 |
| InChIKey | WQMNAGAECODICV-UZTVHIQASA-N |
| XLogP | -1.03 |
| TPSA | 176.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.46 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|