C19H17N7O8S4 — CID 88706105
(6R)-7-[[(2E)-2-(2-formamido-1,3-thiazol-4-yl)-2-(2-formyloxyethoxyimino)acetyl]amino]-8-oxo-3-(1,3,4-thiadiazol-2-ylsulfanylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 88706105) has the molecular formula C19H17N7O8S4 and a molecular weight of 599.65 g/mol. Its IUPAC name is (6R)-7-[[(2E)-2-(2-formamido-1,3-thiazol-4-yl)-2-(2-formyloxyethoxyimino)acetyl]amino]-8-oxo-3-(1,3,4-thiadiazol-2-ylsulfanylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6R)-7-[[(2E)-2-(2-formamido-1,3-thiazol-4-yl)-2-(2-formyloxyethoxyimino)acetyl]amino]-8-oxo-3-(1,3,4-thiadiazol-2-ylsulfanylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 88706105 |
| Molecular Formula | C19H17N7O8S4 |
| Molecular Weight | 599.65 g/mol |
| Exact Mass | 599.00 |
| IUPAC Name | (6R)-7-[[(2E)-2-(2-formamido-1,3-thiazol-4-yl)-2-(2-formyloxyethoxyimino)acetyl]amino]-8-oxo-3-(1,3,4-thiadiazol-2-ylsulfanylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | O=CNc1nc(/C(=N\OCCOC=O)C(=O)NC2C(=O)N3C(C(=O)O)=C(CSc4nncs4)CS[C@H]23)cs1 |
| InChI | InChI=1S/C19H17N7O8S4/c27-6-20-18-22-10(5-36-18)11(25-34-2-1-33-8-28)14(29)23-12-15(30)26-13(17(31)32)9(3-35-16(12)26)4-37-19-24-21-7-38-19/h5-8,12,16H,1-4H2,(H,23,29)(H,31,32)(H,20,22,27)/b25-11+/t12?,16-/m1/s1 |
| InChIKey | GTQZDCUSVVDPPV-RQROINIOSA-N |
| XLogP | -0.01 |
| TPSA | 202.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.65 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|