C20H21N7O7S4 — CID 154410334
(6R)-7-[[2-(2-ethoxyethoxyimino)-2-(2-formamido-1,3-thiazol-4-yl)acetyl]amino]-8-oxo-3-(1,3,4-thiadiazol-2-ylsulfanylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 154410334) has the molecular formula C20H21N7O7S4 and a molecular weight of 599.70 g/mol. Its IUPAC name is (6R)-7-[[2-(2-ethoxyethoxyimino)-2-(2-formamido-1,3-thiazol-4-yl)acetyl]amino]-8-oxo-3-(1,3,4-thiadiazol-2-ylsulfanylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6R)-7-[[2-(2-ethoxyethoxyimino)-2-(2-formamido-1,3-thiazol-4-yl)acetyl]amino]-8-oxo-3-(1,3,4-thiadiazol-2-ylsulfanylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 154410334 |
| Molecular Formula | C20H21N7O7S4 |
| Molecular Weight | 599.70 g/mol |
| Exact Mass | 599.04 |
| IUPAC Name | (6R)-7-[[2-(2-ethoxyethoxyimino)-2-(2-formamido-1,3-thiazol-4-yl)acetyl]amino]-8-oxo-3-(1,3,4-thiadiazol-2-ylsulfanylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | CCOCCON=C(C(=O)NC1C(=O)N2C(C(=O)O)=C(CSc3nncs3)CS[C@H]12)c1csc(NC=O)n1 |
| InChI | InChI=1S/C20H21N7O7S4/c1-2-33-3-4-34-26-12(11-7-36-19(23-11)21-8-28)15(29)24-13-16(30)27-14(18(31)32)10(5-35-17(13)27)6-37-20-25-22-9-38-20/h7-9,13,17H,2-6H2,1H3,(H,24,29)(H,31,32)(H,21,23,28)/t13?,17-/m1/s1 |
| InChIKey | LLRIRYWGMMGPGT-LRHAYUFXSA-N |
| XLogP | 0.85 |
| TPSA | 185.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.70 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|