C18H18N8O6S3 — CID 88723213
(6R)-7-[[(2Z)-2-ethoxyimino-2-(2-formamido-1,3-thiazol-4-yl)acetyl]amino]-8-oxo-3-(2H-triazol-4-ylsulfanylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 88723213) has the molecular formula C18H18N8O6S3 and a molecular weight of 538.59 g/mol. Its IUPAC name is (6R)-7-[[(2Z)-2-ethoxyimino-2-(2-formamido-1,3-thiazol-4-yl)acetyl]amino]-8-oxo-3-(2H-triazol-4-ylsulfanylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6R)-7-[[(2Z)-2-ethoxyimino-2-(2-formamido-1,3-thiazol-4-yl)acetyl]amino]-8-oxo-3-(2H-triazol-4-ylsulfanylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 88723213 |
| Molecular Formula | C18H18N8O6S3 |
| Molecular Weight | 538.59 g/mol |
| Exact Mass | 538.05 |
| IUPAC Name | (6R)-7-[[(2Z)-2-ethoxyimino-2-(2-formamido-1,3-thiazol-4-yl)acetyl]amino]-8-oxo-3-(2H-triazol-4-ylsulfanylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | CCO/N=C(\C(=O)NC1C(=O)N2C(C(=O)O)=C(CSc3cn[nH]n3)CS[C@H]12)c1csc(NC=O)n1 |
| InChI | InChI=1S/C18H18N8O6S3/c1-2-32-24-11(9-6-35-18(21-9)19-7-27)14(28)22-12-15(29)26-13(17(30)31)8(5-34-16(12)26)4-33-10-3-20-25-23-10/h3,6-7,12,16H,2,4-5H2,1H3,(H,22,28)(H,30,31)(H,19,21,27)(H,20,23,25)/b24-11-/t12?,16-/m1/s1 |
| InChIKey | IBBXLFRDEWNVSO-CKDYGOIKSA-N |
| XLogP | 0.10 |
| TPSA | 191.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.59 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|