C18H20N8O5S3 — CID 88722817
(6R)-7-[[(2E)-2-(2-amino-1,3-thiazol-4-yl)-2-propoxyiminoacetyl]amino]-8-oxo-3-(2H-triazol-4-ylsulfanylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 88722817) has the molecular formula C18H20N8O5S3 and a molecular weight of 524.61 g/mol. Its IUPAC name is (6R)-7-[[(2E)-2-(2-amino-1,3-thiazol-4-yl)-2-propoxyiminoacetyl]amino]-8-oxo-3-(2H-triazol-4-ylsulfanylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6R)-7-[[(2E)-2-(2-amino-1,3-thiazol-4-yl)-2-propoxyiminoacetyl]amino]-8-oxo-3-(2H-triazol-4-ylsulfanylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 88722817 |
| Molecular Formula | C18H20N8O5S3 |
| Molecular Weight | 524.61 g/mol |
| Exact Mass | 524.07 |
| IUPAC Name | (6R)-7-[[(2E)-2-(2-amino-1,3-thiazol-4-yl)-2-propoxyiminoacetyl]amino]-8-oxo-3-(2H-triazol-4-ylsulfanylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | CCCO/N=C(/C(=O)NC1C(=O)N2C(C(=O)O)=C(CSc3cn[nH]n3)CS[C@H]12)c1csc(N)n1 |
| InChI | InChI=1S/C18H20N8O5S3/c1-2-3-31-24-11(9-7-34-18(19)21-9)14(27)22-12-15(28)26-13(17(29)30)8(6-33-16(12)26)5-32-10-4-20-25-23-10/h4,7,12,16H,2-3,5-6H2,1H3,(H2,19,21)(H,22,27)(H,29,30)(H,20,23,25)/b24-11+/t12?,16-/m1/s1 |
| InChIKey | UUQZMBBDRNPRKO-XAXMJLBDSA-N |
| XLogP | 0.50 |
| TPSA | 188.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.61 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|