C20H21N9O6S3 — CID 88729666
(6S)-7-[[2-ethoxyimino-2-(2-formamido-1,3-thiazol-4-yl)acetyl]amino]-8-oxo-3-[(1-prop-2-ynyl-2H-tetrazol-3-yl)sulfanylmethyl]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 88729666) has the molecular formula C20H21N9O6S3 and a molecular weight of 579.65 g/mol. Its IUPAC name is (6S)-7-[[2-ethoxyimino-2-(2-formamido-1,3-thiazol-4-yl)acetyl]amino]-8-oxo-3-[(1-prop-2-ynyl-2H-tetrazol-3-yl)sulfanylmethyl]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6S)-7-[[2-ethoxyimino-2-(2-formamido-1,3-thiazol-4-yl)acetyl]amino]-8-oxo-3-[(1-prop-2-ynyl-2H-tetrazol-3-yl)sulfanylmethyl]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 88729666 |
| Molecular Formula | C20H21N9O6S3 |
| Molecular Weight | 579.65 g/mol |
| Exact Mass | 579.08 |
| IUPAC Name | (6S)-7-[[2-ethoxyimino-2-(2-formamido-1,3-thiazol-4-yl)acetyl]amino]-8-oxo-3-[(1-prop-2-ynyl-2H-tetrazol-3-yl)sulfanylmethyl]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | C#CCN1C=NN(SCC2=C(C(=O)O)N3C(=O)C(NC(=O)C(=NOCC)c4csc(NC=O)n4)[C@@H]3SC2)N1 |
| InChI | InChI=1S/C20H21N9O6S3/c1-3-5-27-9-22-29(26-27)38-7-11-6-36-18-14(17(32)28(18)15(11)19(33)34)24-16(31)13(25-35-4-2)12-8-37-20(23-12)21-10-30/h1,8-10,14,18,26H,4-7H2,2H3,(H,24,31)(H,33,34)(H,21,23,30)/t14?,18-/m0/s1 |
| InChIKey | LDGABTYJOOSPLV-IBYPIGCZSA-N |
| XLogP | -0.55 |
| TPSA | 181.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.65 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|