C18H20N6O8S2 — CID 54433325
(6S)-3-(carbamoyloxymethyl)-7-[[2-(2-formamido-1,3-thiazol-4-yl)-2-propan-2-yloxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 54433325) has the molecular formula C18H20N6O8S2 and a molecular weight of 512.53 g/mol. Its IUPAC name is (6S)-3-(carbamoyloxymethyl)-7-[[2-(2-formamido-1,3-thiazol-4-yl)-2-propan-2-yloxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6S)-3-(carbamoyloxymethyl)-7-[[2-(2-formamido-1,3-thiazol-4-yl)-2-propan-2-yloxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 54433325 |
| Molecular Formula | C18H20N6O8S2 |
| Molecular Weight | 512.53 g/mol |
| Exact Mass | 512.08 |
| IUPAC Name | (6S)-3-(carbamoyloxymethyl)-7-[[2-(2-formamido-1,3-thiazol-4-yl)-2-propan-2-yloxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | CC(C)ON=C(C(=O)NC1C(=O)N2C(C(=O)O)=C(COC(N)=O)CS[C@@H]12)c1csc(NC=O)n1 |
| InChI | InChI=1S/C18H20N6O8S2/c1-7(2)32-23-10(9-5-34-18(21-9)20-6-25)13(26)22-11-14(27)24-12(16(28)29)8(3-31-17(19)30)4-33-15(11)24/h5-7,11,15H,3-4H2,1-2H3,(H2,19,30)(H,22,26)(H,28,29)(H,20,21,25)/t11?,15-/m0/s1 |
| InChIKey | WJAMACSEPOLYRH-MHTVFEQDSA-N |
| XLogP | -0.33 |
| TPSA | 202.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.53 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|