C35H32ClN5O5S2 — CID 57240126
(6S)-3-(chloromethyl)-8-oxo-7-[[2-propan-2-yloxyimino-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetyl]amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 57240126) has the molecular formula C35H32ClN5O5S2 and a molecular weight of 702.26 g/mol. Its IUPAC name is (6S)-3-(chloromethyl)-8-oxo-7-[[2-propan-2-yloxyimino-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetyl]amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6S)-3-(chloromethyl)-8-oxo-7-[[2-propan-2-yloxyimino-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetyl]amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 57240126 |
| Molecular Formula | C35H32ClN5O5S2 |
| Molecular Weight | 702.26 g/mol |
| Exact Mass | 701.15 |
| IUPAC Name | (6S)-3-(chloromethyl)-8-oxo-7-[[2-propan-2-yloxyimino-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetyl]amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | CC(C)ON=C(C(=O)NC1C(=O)N2C(C(=O)O)=C(CCl)CS[C@@H]12)c1csc(NC(c2ccccc2)(c2ccccc2)c2ccccc2)n1 |
| InChI | InChI=1S/C35H32ClN5O5S2/c1-21(2)46-40-27(30(42)38-28-31(43)41-29(33(44)45)22(18-36)19-47-32(28)41)26-20-48-34(37-26)39-35(23-12-6-3-7-13-23,24-14-8-4-9-15-24)25-16-10-5-11-17-25/h3-17,20-21,28,32H,18-19H2,1-2H3,(H,37,39)(H,38,42)(H,44,45)/t28?,32-/m0/s1 |
| InChIKey | UCPDZYMBYCSVPI-YYMSGCCCSA-N |
| XLogP | 5.65 |
| TPSA | 133.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.26 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|