C14H15ClN5O5PS2 — CID 89181522
(6R,7R)-3-(chloromethyl)-7-[[(2Z)-2-methoxyimino-2-[2-(phosphanylamino)-1,3-thiazol-4-yl]acetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 89181522) has the molecular formula C14H15ClN5O5PS2 and a molecular weight of 463.87 g/mol. Its IUPAC name is (6R,7R)-3-(chloromethyl)-7-[[(2Z)-2-methoxyimino-2-[2-(phosphanylamino)-1,3-thiazol-4-yl]acetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6R,7R)-3-(chloromethyl)-7-[[(2Z)-2-methoxyimino-2-[2-(phosphanylamino)-1,3-thiazol-4-yl]acetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 89181522 |
| Molecular Formula | C14H15ClN5O5PS2 |
| Molecular Weight | 463.87 g/mol |
| Exact Mass | 462.99 |
| IUPAC Name | (6R,7R)-3-(chloromethyl)-7-[[(2Z)-2-methoxyimino-2-[2-(phosphanylamino)-1,3-thiazol-4-yl]acetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | CO/N=C(\C(=O)N[C@@H]1C(=O)N2C(C(=O)O)=C(CCl)CS[C@H]12)c1csc(NP)n1 |
| InChI | InChI=1S/C14H15ClN5O5PS2/c1-25-18-7(6-4-28-14(16-6)19-26)10(21)17-8-11(22)20-9(13(23)24)5(2-15)3-27-12(8)20/h4,8,12H,2-3,26H2,1H3,(H,16,19)(H,17,21)(H,23,24)/b18-7-/t8-,12-/m1/s1 |
| InChIKey | IJFWXZLZOCWGRS-GHXIOONMSA-N |
| XLogP | 0.67 |
| TPSA | 133.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.87 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|