C16H19N7O7S2 — CID 88659137
(6R)-7-[[(2Z)-2-(2-aminoethoxyimino)-2-(2-amino-1,3-thiazol-4-yl)acetyl]amino]-3-(carbamoyloxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 88659137) has the molecular formula C16H19N7O7S2 and a molecular weight of 485.50 g/mol. Its IUPAC name is (6R)-7-[[(2Z)-2-(2-aminoethoxyimino)-2-(2-amino-1,3-thiazol-4-yl)acetyl]amino]-3-(carbamoyloxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6R)-7-[[(2Z)-2-(2-aminoethoxyimino)-2-(2-amino-1,3-thiazol-4-yl)acetyl]amino]-3-(carbamoyloxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 88659137 |
| Molecular Formula | C16H19N7O7S2 |
| Molecular Weight | 485.50 g/mol |
| Exact Mass | 485.08 |
| IUPAC Name | (6R)-7-[[(2Z)-2-(2-aminoethoxyimino)-2-(2-amino-1,3-thiazol-4-yl)acetyl]amino]-3-(carbamoyloxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | NCCO/N=C(\C(=O)NC1C(=O)N2C(C(=O)O)=C(COC(N)=O)CS[C@H]12)c1csc(N)n1 |
| InChI | InChI=1S/C16H19N7O7S2/c17-1-2-30-22-8(7-5-32-15(18)20-7)11(24)21-9-12(25)23-10(14(26)27)6(3-29-16(19)28)4-31-13(9)23/h5,9,13H,1-4,17H2,(H2,18,20)(H2,19,28)(H,21,24)(H,26,27)/b22-8-/t9?,13-/m1/s1 |
| InChIKey | HDVXQDRGJGQYAO-WOXHVUALSA-N |
| XLogP | -1.76 |
| TPSA | 225.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.50 |
| LogP ≤ 5 | -1.76 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|