C17H19N5O8S2 — CID 173406471
(6R)-7-[[2-(2-formamido-1,3-thiazol-4-yl)-2-(2-formyloxyethoxyimino)acetyl]amino]-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid (PubChem CID 173406471) has the molecular formula C17H19N5O8S2 and a molecular weight of 485.50 g/mol. Its IUPAC name is (6R)-7-[[2-(2-formamido-1,3-thiazol-4-yl)-2-(2-formyloxyethoxyimino)acetyl]amino]-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid.
| Compound Name | (6R)-7-[[2-(2-formamido-1,3-thiazol-4-yl)-2-(2-formyloxyethoxyimino)acetyl]amino]-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid |
|---|---|
| PubChem CID | 173406471 |
| Molecular Formula | C17H19N5O8S2 |
| Molecular Weight | 485.50 g/mol |
| Exact Mass | 485.07 |
| IUPAC Name | (6R)-7-[[2-(2-formamido-1,3-thiazol-4-yl)-2-(2-formyloxyethoxyimino)acetyl]amino]-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid |
| SMILES | CC1(C(=O)O)CS[C@@H]2C(NC(=O)C(=NOCCOC=O)c3csc(NC=O)n3)C(=O)N2C1 |
| InChI | InChI=1S/C17H19N5O8S2/c1-17(15(27)28)5-22-13(26)11(14(22)32-6-17)20-12(25)10(21-30-3-2-29-8-24)9-4-31-16(19-9)18-7-23/h4,7-8,11,14H,2-3,5-6H2,1H3,(H,20,25)(H,27,28)(H,18,19,23)/t11?,14-,17?/m1/s1 |
| InChIKey | SNBSNMGILPRHBU-CHHLVHLRSA-N |
| XLogP | -0.90 |
| TPSA | 176.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.50 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|