C30H25Br2N5O8S2 — CID 173395371
(6R)-7-[[2-(2-benzhydryloxy-2-oxoethoxy)imino-2-(2-formamido-1,3-thiazol-4-yl)acetyl]amino]-3-(2,2-dibromoethenyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid (PubChem CID 173395371) has the molecular formula C30H25Br2N5O8S2 and a molecular weight of 807.50 g/mol. Its IUPAC name is (6R)-7-[[2-(2-benzhydryloxy-2-oxoethoxy)imino-2-(2-formamido-1,3-thiazol-4-yl)acetyl]amino]-3-(2,2-dibromoethenyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid.
| Compound Name | (6R)-7-[[2-(2-benzhydryloxy-2-oxoethoxy)imino-2-(2-formamido-1,3-thiazol-4-yl)acetyl]amino]-3-(2,2-dibromoethenyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid |
|---|---|
| PubChem CID | 173395371 |
| Molecular Formula | C30H25Br2N5O8S2 |
| Molecular Weight | 807.50 g/mol |
| Exact Mass | 804.95 |
| IUPAC Name | (6R)-7-[[2-(2-benzhydryloxy-2-oxoethoxy)imino-2-(2-formamido-1,3-thiazol-4-yl)acetyl]amino]-3-(2,2-dibromoethenyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid |
| SMILES | O=CNc1nc(C(=NOCC(=O)OC(c2ccccc2)c2ccccc2)C(=O)NC2C(=O)N3CC(C=C(Br)Br)(C(=O)O)CS[C@H]23)cs1 |
| InChI | InChI=1S/C30H25Br2N5O8S2/c31-20(32)11-30(28(42)43)14-37-26(41)23(27(37)47-15-30)35-25(40)22(19-13-46-29(34-19)33-16-38)36-44-12-21(39)45-24(17-7-3-1-4-8-17)18-9-5-2-6-10-18/h1-11,13,16,23-24,27H,12,14-15H2,(H,35,40)(H,42,43)(H,33,34,38)/t23?,27-,30?/m1/s1 |
| InChIKey | ZYWMMWFJYQRNDS-DLPZQXBVSA-N |
| XLogP | 3.87 |
| TPSA | 176.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 807.50 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|