C30H27N5O6S2 — CID 54160970
benzhydryl (6S)-3-ethenyl-7-[[2-ethoxyimino-2-(2-formamido-1,3-thiazol-4-yl)acetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 54160970) has the molecular formula C30H27N5O6S2 and a molecular weight of 617.71 g/mol. Its IUPAC name is benzhydryl (6S)-3-ethenyl-7-[[2-ethoxyimino-2-(2-formamido-1,3-thiazol-4-yl)acetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | benzhydryl (6S)-3-ethenyl-7-[[2-ethoxyimino-2-(2-formamido-1,3-thiazol-4-yl)acetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 54160970 |
| Molecular Formula | C30H27N5O6S2 |
| Molecular Weight | 617.71 g/mol |
| Exact Mass | 617.14 |
| IUPAC Name | benzhydryl (6S)-3-ethenyl-7-[[2-ethoxyimino-2-(2-formamido-1,3-thiazol-4-yl)acetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | C=CC1=C(C(=O)OC(c2ccccc2)c2ccccc2)N2C(=O)C(NC(=O)C(=NOCC)c3csc(NC=O)n3)[C@@H]2SC1 |
| InChI | InChI=1S/C30H27N5O6S2/c1-3-18-15-42-28-23(33-26(37)22(34-40-4-2)21-16-43-30(32-21)31-17-36)27(38)35(28)24(18)29(39)41-25(19-11-7-5-8-12-19)20-13-9-6-10-14-20/h3,5-14,16-17,23,25,28H,1,4,15H2,2H3,(H,33,37)(H,31,32,36)/t23?,28-/m0/s1 |
| InChIKey | OOJHTKKRFXDAQR-WOKNPCPGSA-N |
| XLogP | 3.62 |
| TPSA | 139.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.71 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|