C31H30ClN5O7S2 — CID 131713974
benzhydryl (6R)-7-[[2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-ethoxyiminoacetyl]amino]-3-(methoxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 131713974) has the molecular formula C31H30ClN5O7S2 and a molecular weight of 684.20 g/mol. Its IUPAC name is benzhydryl (6R)-7-[[2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-ethoxyiminoacetyl]amino]-3-(methoxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | benzhydryl (6R)-7-[[2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-ethoxyiminoacetyl]amino]-3-(methoxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 131713974 |
| Molecular Formula | C31H30ClN5O7S2 |
| Molecular Weight | 684.20 g/mol |
| Exact Mass | 683.13 |
| IUPAC Name | benzhydryl (6R)-7-[[2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-ethoxyiminoacetyl]amino]-3-(methoxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | CCON=C(C(=O)NC1C(=O)N2C(C(=O)OC(c3ccccc3)c3ccccc3)=C(COC)CS[C@H]12)c1csc(NC(=O)CCl)n1 |
| InChI | InChI=1S/C31H30ClN5O7S2/c1-3-43-36-23(21-17-46-31(33-21)34-22(38)14-32)27(39)35-24-28(40)37-25(20(15-42-2)16-45-29(24)37)30(41)44-26(18-10-6-4-7-11-18)19-12-8-5-9-13-19/h4-13,17,24,26,29H,3,14-16H2,1-2H3,(H,35,39)(H,33,34,38)/t24?,29-/m1/s1 |
| InChIKey | CXMISXNRKQUCFF-HOINCLMKSA-N |
| XLogP | 3.69 |
| TPSA | 148.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.20 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|