C28H25N5O7S2 — CID 88626082
benzhydryl (6R)-7-[[(2Z)-2-(2-formamido-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-(hydroxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 88626082) has the molecular formula C28H25N5O7S2 and a molecular weight of 607.67 g/mol. Its IUPAC name is benzhydryl (6R)-7-[[(2Z)-2-(2-formamido-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-(hydroxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | benzhydryl (6R)-7-[[(2Z)-2-(2-formamido-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-(hydroxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 88626082 |
| Molecular Formula | C28H25N5O7S2 |
| Molecular Weight | 607.67 g/mol |
| Exact Mass | 607.12 |
| IUPAC Name | benzhydryl (6R)-7-[[(2Z)-2-(2-formamido-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-(hydroxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | CO/N=C(\C(=O)NC1C(=O)N2C(C(=O)OC(c3ccccc3)c3ccccc3)=C(CO)CS[C@H]12)c1csc(NC=O)n1 |
| InChI | InChI=1S/C28H25N5O7S2/c1-39-32-20(19-14-42-28(30-19)29-15-35)24(36)31-21-25(37)33-22(18(12-34)13-41-26(21)33)27(38)40-23(16-8-4-2-5-9-16)17-10-6-3-7-11-17/h2-11,14-15,21,23,26,34H,12-13H2,1H3,(H,31,36)(H,29,30,35)/b32-20-/t21?,26-/m1/s1 |
| InChIKey | WURDVYDZMWCUJU-MRJXIXLFSA-N |
| XLogP | 2.04 |
| TPSA | 159.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.67 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|