C29H23N5O7S2 — CID 88626028
benzhydryl (6R)-3-ethynyl-7-[[(2E)-2-(2-formamido-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-5,8-dioxo-5λ4-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 88626028) has the molecular formula C29H23N5O7S2 and a molecular weight of 617.67 g/mol. Its IUPAC name is benzhydryl (6R)-3-ethynyl-7-[[(2E)-2-(2-formamido-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-5,8-dioxo-5λ4-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | benzhydryl (6R)-3-ethynyl-7-[[(2E)-2-(2-formamido-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-5,8-dioxo-5λ4-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 88626028 |
| Molecular Formula | C29H23N5O7S2 |
| Molecular Weight | 617.67 g/mol |
| Exact Mass | 617.10 |
| IUPAC Name | benzhydryl (6R)-3-ethynyl-7-[[(2E)-2-(2-formamido-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-5,8-dioxo-5λ4-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | C#CC1=C(C(=O)OC(c2ccccc2)c2ccccc2)N2C(=O)C(NC(=O)/C(=N/OC)c3csc(NC=O)n3)[C@H]2S(=O)C1 |
| InChI | InChI=1S/C29H23N5O7S2/c1-3-17-15-43(39)27-22(32-25(36)21(33-40-2)20-14-42-29(31-20)30-16-35)26(37)34(27)23(17)28(38)41-24(18-10-6-4-7-11-18)19-12-8-5-9-13-19/h1,4-14,16,22,24,27H,15H2,2H3,(H,32,36)(H,30,31,35)/b33-21+/t22?,27-,43?/m1/s1 |
| InChIKey | MMILOUGUDAIPDO-SHYIVGINSA-N |
| XLogP | 1.70 |
| TPSA | 156.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.67 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|